C11H18O4 — CID 11106722
[(3R,4aS,5R,6R,7aR)-5-hydroxy-6-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-3-yl] acetate (PubChem CID 11106722) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is [(3R,4aS,5R,6R,7aR)-5-hydroxy-6-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-3-yl] acetate.
| Compound Name | [(3R,4aS,5R,6R,7aR)-5-hydroxy-6-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 11106722 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(3R,4aS,5R,6R,7aR)-5-hydroxy-6-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CO[C@@H]2C[C@@H](C)[C@@H](O)[C@@H]2C1 |
| InChI | InChI=1S/C11H18O4/c1-6-3-10-9(11(6)13)4-8(5-14-10)15-7(2)12/h6,8-11,13H,3-5H2,1-2H3/t6-,8-,9-,10-,11-/m1/s1 |
| InChIKey | TUMAMFPVCOMQOV-NENRSDFPSA-N |
| XLogP | 0.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |