C18H27BO9 — CID 160602158
CID 160602158 (PubChem CID 160602158) has the molecular formula C18H27BO9 and a molecular weight of 398.22 g/mol.
| Compound Name | CID 160602158 |
|---|---|
| PubChem CID | 160602158 |
| Molecular Formula | C18H27BO9 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H]1C2OC[C@@H](C)C2O[C@H]1C.[B][C@@H]1OC2C(OC[C@H]2O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H16O4.C8H11BO5/c1-5-4-12-10-8(5)13-6(2)9(10)14-7(3)11;1-3(10)13-7-6-5(14-8(7)9)4(11)2-12-6/h5-6,8-10H,4H2,1-3H3;4-8,11H,2H2,1H3/t5-,6+,8?,9+,10?;4-,5?,6?,7-,8-/m11/s1 |
| InChIKey | KUZBRUWTCXXAQQ-GBDSNTOESA-N |
| XLogP | -0.69 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|