C7H12O3 — CID 115094726
(2-cyclopropyl-1,3-dioxolan-4-yl)methanol (PubChem CID 115094726) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2-cyclopropyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (2-cyclopropyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 115094726 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (2-cyclopropyl-1,3-dioxolan-4-yl)methanol |
| SMILES | OCC1COC(C2CC2)O1 |
| InChI | InChI=1S/C7H12O3/c8-3-6-4-9-7(10-6)5-1-2-5/h5-8H,1-4H2 |
| InChIKey | SYWHVIOUJBEOGH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |