C11H17ClO2 — CID 130608231
2-(2-bicyclo[2.2.1]heptanyl)-4-(chloromethyl)-1,3-dioxolane (PubChem CID 130608231) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-4-(chloromethyl)-1,3-dioxolane.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-4-(chloromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 130608231 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-4-(chloromethyl)-1,3-dioxolane |
| SMILES | ClCC1COC(C2CC3CCC2C3)O1 |
| InChI | InChI=1S/C11H17ClO2/c12-5-9-6-13-11(14-9)10-4-7-1-2-8(10)3-7/h7-11H,1-6H2 |
| InChIKey | IEUOVFFQPQVDKT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|