C11H15ClO2 — CID 98152417
(2R,4R)-2-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-4-(chloromethyl)-1,3-dioxolane (PubChem CID 98152417) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is (2R,4R)-2-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-4-(chloromethyl)-1,3-dioxolane.
| Compound Name | (2R,4R)-2-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-4-(chloromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 98152417 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2R,4R)-2-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-4-(chloromethyl)-1,3-dioxolane |
| SMILES | ClC[C@H]1CO[C@@H]([C@H]2C[C@@H]3C=C[C@@H]2C3)O1 |
| InChI | InChI=1S/C11H15ClO2/c12-5-9-6-13-11(14-9)10-4-7-1-2-8(10)3-7/h1-2,7-11H,3-6H2/t7-,8-,9+,10+,11-/m1/s1 |
| InChIKey | IMAZNHMBJHURDA-SAVGLBRCSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|