C14H22O — CID 101130839
2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyloxane (PubChem CID 101130839) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyloxane.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyloxane |
|---|---|
| PubChem CID | 101130839 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyloxane |
| SMILES | CC1CC(C)OC(C2CC3C=CC2C3)C1 |
| InChI | InChI=1S/C14H22O/c1-9-5-10(2)15-14(6-9)13-8-11-3-4-12(13)7-11/h3-4,9-14H,5-8H2,1-2H3 |
| InChIKey | CSLLUMGCLAJOSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|