C14H22 — CID 163949457
5-(4-methylcyclohexyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 163949457) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 5-(4-methylcyclohexyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(4-methylcyclohexyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 163949457 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 5-(4-methylcyclohexyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CC1CCC(C2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C14H22/c1-10-2-5-12(6-3-10)14-9-11-4-7-13(14)8-11/h4,7,10-14H,2-3,5-6,8-9H2,1H3 |
| InChIKey | QEGXVJBTFSMPQK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|