C22H42O3 — CID 69239152
2-butyl-4,4,6-trimethyl-1,3-dioxane;2-hexylcyclopentan-1-one (PubChem CID 69239152) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2-butyl-4,4,6-trimethyl-1,3-dioxane;2-hexylcyclopentan-1-one.
| Compound Name | 2-butyl-4,4,6-trimethyl-1,3-dioxane;2-hexylcyclopentan-1-one |
|---|---|
| PubChem CID | 69239152 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 2-butyl-4,4,6-trimethyl-1,3-dioxane;2-hexylcyclopentan-1-one |
| SMILES | CCCCC1OC(C)CC(C)(C)O1.CCCCCCC1CCCC1=O |
| InChI | InChI=1S/C11H22O2.C11H20O/c1-5-6-7-10-12-9(2)8-11(3,4)13-10;1-2-3-4-5-7-10-8-6-9-11(10)12/h9-10H,5-8H2,1-4H3;10H,2-9H2,1H3 |
| InChIKey | DJERZURXFYMHBK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|