C14H21NO2 — CID 141093254
4-hexyl-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 141093254) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-hexyl-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 4-hexyl-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 141093254 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-hexyl-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCCCC1CCCC2=C1C(=O)NC2=O |
| InChI | InChI=1S/C14H21NO2/c1-2-3-4-5-7-10-8-6-9-11-12(10)14(17)15-13(11)16/h10H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | KSEZZMQZRRQNHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|