C23H36O2S — CID 58401147
5,5-dioctylcyclopenta[c]thiophene-4,6-dione (PubChem CID 58401147) has the molecular formula C23H36O2S and a molecular weight of 376.61 g/mol. Its IUPAC name is 5,5-dioctylcyclopenta[c]thiophene-4,6-dione.
| Compound Name | 5,5-dioctylcyclopenta[c]thiophene-4,6-dione |
|---|---|
| PubChem CID | 58401147 |
| Molecular Formula | C23H36O2S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 5,5-dioctylcyclopenta[c]thiophene-4,6-dione |
| SMILES | CCCCCCCCC1(CCCCCCCC)C(=O)c2cscc2C1=O |
| InChI | InChI=1S/C23H36O2S/c1-3-5-7-9-11-13-15-23(16-14-12-10-8-6-4-2)21(24)19-17-26-18-20(19)22(23)25/h17-18H,3-16H2,1-2H3 |
| InChIKey | ZRZNYFAMUWCGGJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|