C14H25N — CID 101151039
4-hexyl-2,4,6-trimethyl-1H-pyridine (PubChem CID 101151039) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 4-hexyl-2,4,6-trimethyl-1H-pyridine.
| Compound Name | 4-hexyl-2,4,6-trimethyl-1H-pyridine |
|---|---|
| PubChem CID | 101151039 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 4-hexyl-2,4,6-trimethyl-1H-pyridine |
| SMILES | CCCCCCC1(C)C=C(C)NC(C)=C1 |
| InChI | InChI=1S/C14H25N/c1-5-6-7-8-9-14(4)10-12(2)15-13(3)11-14/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | UDFHNURWXUCROQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|