C19H30Br2N2 — CID 142702409
4,7-dibromo-2,2-dihexyl-1,3-dihydrobenzimidazole (PubChem CID 142702409) has the molecular formula C19H30Br2N2 and a molecular weight of 446.27 g/mol. Its IUPAC name is 4,7-dibromo-2,2-dihexyl-1,3-dihydrobenzimidazole.
| Compound Name | 4,7-dibromo-2,2-dihexyl-1,3-dihydrobenzimidazole |
|---|---|
| PubChem CID | 142702409 |
| Molecular Formula | C19H30Br2N2 |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4,7-dibromo-2,2-dihexyl-1,3-dihydrobenzimidazole |
| SMILES | CCCCCCC1(CCCCCC)Nc2c(Br)ccc(Br)c2N1 |
| InChI | InChI=1S/C19H30Br2N2/c1-3-5-7-9-13-19(14-10-8-6-4-2)22-17-15(20)11-12-16(21)18(17)23-19/h11-12,22-23H,3-10,13-14H2,1-2H3 |
| InChIKey | XPTISAGKEDZNHP-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|