C14H20BrCl2N — CID 107787758
4-bromo-2,3-dichloro-N-octylaniline (PubChem CID 107787758) has the molecular formula C14H20BrCl2N and a molecular weight of 353.13 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-octylaniline.
| Compound Name | 4-bromo-2,3-dichloro-N-octylaniline |
|---|---|
| PubChem CID | 107787758 |
| Molecular Formula | C14H20BrCl2N |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-octylaniline |
| SMILES | CCCCCCCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H20BrCl2N/c1-2-3-4-5-6-7-10-18-12-9-8-11(15)13(16)14(12)17/h8-9,18H,2-7,10H2,1H3 |
| InChIKey | LNLYZUNFQKVXDB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|