C10H12BrCl2NO — CID 104589265
4-bromo-2,3-dichloro-N-(3-methoxypropyl)aniline (PubChem CID 104589265) has the molecular formula C10H12BrCl2NO and a molecular weight of 313.02 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(3-methoxypropyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(3-methoxypropyl)aniline |
|---|---|
| PubChem CID | 104589265 |
| Molecular Formula | C10H12BrCl2NO |
| Molecular Weight | 313.02 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(3-methoxypropyl)aniline |
| SMILES | COCCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H12BrCl2NO/c1-15-6-2-5-14-8-4-3-7(11)9(12)10(8)13/h3-4,14H,2,5-6H2,1H3 |
| InChIKey | YINRXMKSBBBYGW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|