C14H12BrCl2N — CID 114001623
4-bromo-2,3-dichloro-N-(2-phenylethyl)aniline (PubChem CID 114001623) has the molecular formula C14H12BrCl2N and a molecular weight of 345.07 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(2-phenylethyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(2-phenylethyl)aniline |
|---|---|
| PubChem CID | 114001623 |
| Molecular Formula | C14H12BrCl2N |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(2-phenylethyl)aniline |
| SMILES | Clc1c(Br)ccc(NCCc2ccccc2)c1Cl |
| InChI | InChI=1S/C14H12BrCl2N/c15-11-6-7-12(14(17)13(11)16)18-9-8-10-4-2-1-3-5-10/h1-7,18H,8-9H2 |
| InChIKey | ACAQOFCEOYQNBF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|