C13H11BrCl2N2 — CID 114001741
4-bromo-2,3-dichloro-N-(2-pyridin-4-ylethyl)aniline (PubChem CID 114001741) has the molecular formula C13H11BrCl2N2 and a molecular weight of 346.06 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(2-pyridin-4-ylethyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(2-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 114001741 |
| Molecular Formula | C13H11BrCl2N2 |
| Molecular Weight | 346.06 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(2-pyridin-4-ylethyl)aniline |
| SMILES | Clc1c(Br)ccc(NCCc2ccncc2)c1Cl |
| InChI | InChI=1S/C13H11BrCl2N2/c14-10-1-2-11(13(16)12(10)15)18-8-5-9-3-6-17-7-4-9/h1-4,6-7,18H,5,8H2 |
| InChIKey | PVUCQALJXQMTJF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|