C10H8BrCl2N — CID 107788934
4-bromo-N-but-3-ynyl-2,3-dichloroaniline (PubChem CID 107788934) has the molecular formula C10H8BrCl2N and a molecular weight of 292.99 g/mol. Its IUPAC name is 4-bromo-N-but-3-ynyl-2,3-dichloroaniline.
| Compound Name | 4-bromo-N-but-3-ynyl-2,3-dichloroaniline |
|---|---|
| PubChem CID | 107788934 |
| Molecular Formula | C10H8BrCl2N |
| Molecular Weight | 292.99 g/mol |
| Exact Mass | 290.92 |
| IUPAC Name | 4-bromo-N-but-3-ynyl-2,3-dichloroaniline |
| SMILES | C#CCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H8BrCl2N/c1-2-3-6-14-8-5-4-7(11)9(12)10(8)13/h1,4-5,14H,3,6H2 |
| InChIKey | QLMZOEWJWSURJV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|