C12H16BrCl2NO2 — CID 107789122
4-bromo-2,3-dichloro-N-[3-(2-methoxyethoxy)propyl]aniline (PubChem CID 107789122) has the molecular formula C12H16BrCl2NO2 and a molecular weight of 357.08 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[3-(2-methoxyethoxy)propyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[3-(2-methoxyethoxy)propyl]aniline |
|---|---|
| PubChem CID | 107789122 |
| Molecular Formula | C12H16BrCl2NO2 |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[3-(2-methoxyethoxy)propyl]aniline |
| SMILES | COCCOCCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H16BrCl2NO2/c1-17-7-8-18-6-2-5-16-10-4-3-9(13)11(14)12(10)15/h3-4,16H,2,5-8H2,1H3 |
| InChIKey | MBQNAEBTHMZJFH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|