C15H22BrCl2NO2 — CID 107788923
1-(4-bromo-2,3-dichloroanilino)-3-(4-methylpentoxy)propan-2-ol (PubChem CID 107788923) has the molecular formula C15H22BrCl2NO2 and a molecular weight of 399.16 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichloroanilino)-3-(4-methylpentoxy)propan-2-ol.
| Compound Name | 1-(4-bromo-2,3-dichloroanilino)-3-(4-methylpentoxy)propan-2-ol |
|---|---|
| PubChem CID | 107788923 |
| Molecular Formula | C15H22BrCl2NO2 |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 1-(4-bromo-2,3-dichloroanilino)-3-(4-methylpentoxy)propan-2-ol |
| SMILES | CC(C)CCCOCC(O)CNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C15H22BrCl2NO2/c1-10(2)4-3-7-21-9-11(20)8-19-13-6-5-12(16)14(17)15(13)18/h5-6,10-11,19-20H,3-4,7-9H2,1-2H3 |
| InChIKey | JMHNKOIXROMVTL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|