C15H22BrF2NO2 — CID 60900257
1-(2-bromo-4,6-difluoroanilino)-3-(4-methylpentoxy)propan-2-ol (PubChem CID 60900257) has the molecular formula C15H22BrF2NO2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluoroanilino)-3-(4-methylpentoxy)propan-2-ol.
| Compound Name | 1-(2-bromo-4,6-difluoroanilino)-3-(4-methylpentoxy)propan-2-ol |
|---|---|
| PubChem CID | 60900257 |
| Molecular Formula | C15H22BrF2NO2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-(2-bromo-4,6-difluoroanilino)-3-(4-methylpentoxy)propan-2-ol |
| SMILES | CC(C)CCCOCC(O)CNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C15H22BrF2NO2/c1-10(2)4-3-5-21-9-12(20)8-19-15-13(16)6-11(17)7-14(15)18/h6-7,10,12,19-20H,3-5,8-9H2,1-2H3 |
| InChIKey | ACSYZJHDAJVUOP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|