C12H15BrCl2N2O — CID 114001735
4-(4-bromo-2,3-dichloroanilino)-N,N-dimethylbutanamide (PubChem CID 114001735) has the molecular formula C12H15BrCl2N2O and a molecular weight of 354.08 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dichloroanilino)-N,N-dimethylbutanamide.
| Compound Name | 4-(4-bromo-2,3-dichloroanilino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 114001735 |
| Molecular Formula | C12H15BrCl2N2O |
| Molecular Weight | 354.08 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 4-(4-bromo-2,3-dichloroanilino)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H15BrCl2N2O/c1-17(2)10(18)4-3-7-16-9-6-5-8(13)11(14)12(9)15/h5-6,16H,3-4,7H2,1-2H3 |
| InChIKey | SSGAYEYOZZRXQZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.08 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|