C11H13BrCl2N2O4S — CID 107787368
methyl 3-[(4-bromo-2,3-dichlorophenyl)sulfamoyl-methylamino]propanoate (PubChem CID 107787368) has the molecular formula C11H13BrCl2N2O4S and a molecular weight of 420.11 g/mol. Its IUPAC name is methyl 3-[(4-bromo-2,3-dichlorophenyl)sulfamoyl-methylamino]propanoate.
| Compound Name | methyl 3-[(4-bromo-2,3-dichlorophenyl)sulfamoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 107787368 |
| Molecular Formula | C11H13BrCl2N2O4S |
| Molecular Weight | 420.11 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | methyl 3-[(4-bromo-2,3-dichlorophenyl)sulfamoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13BrCl2N2O4S/c1-16(6-5-9(17)20-2)21(18,19)15-8-4-3-7(12)10(13)11(8)14/h3-4,15H,5-6H2,1-2H3 |
| InChIKey | RJLATCWZPNGKHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.11 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|