C13H19BrN2O4S — CID 81356656
methyl 3-[[(1S)-1-(4-bromophenyl)ethyl]sulfamoyl-methylamino]propanoate (PubChem CID 81356656) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-(4-bromophenyl)ethyl]sulfamoyl-methylamino]propanoate.
| Compound Name | methyl 3-[[(1S)-1-(4-bromophenyl)ethyl]sulfamoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 81356656 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | methyl 3-[[(1S)-1-(4-bromophenyl)ethyl]sulfamoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)N[C@@H](C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN2O4S/c1-10(11-4-6-12(14)7-5-11)15-21(18,19)16(2)9-8-13(17)20-3/h4-7,10,15H,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | HTLFCBRYSQOCSO-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |