C9H14N2O4S2 — CID 66351480
methyl 3-[methyl(thiophen-3-ylsulfamoyl)amino]propanoate (PubChem CID 66351480) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 3-[methyl(thiophen-3-ylsulfamoyl)amino]propanoate.
| Compound Name | methyl 3-[methyl(thiophen-3-ylsulfamoyl)amino]propanoate |
|---|---|
| PubChem CID | 66351480 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | methyl 3-[methyl(thiophen-3-ylsulfamoyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)Nc1ccsc1 |
| InChI | InChI=1S/C9H14N2O4S2/c1-11(5-3-9(12)15-2)17(13,14)10-8-4-6-16-7-8/h4,6-7,10H,3,5H2,1-2H3 |
| InChIKey | ZBFNBFCCTOQXDD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |