methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate

C9H15N3O5S — CID 104600365

IUPACmethyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate
SMILESCOC(=O)CCN(C)S(=O)(=O)NCc1ccno1
InChIInChI=1S/C9H15N3O5S/c1-12(6-4-9(13)16-2)18(14,15)11-7-8-3-5-10-17-8/h3,5,11H,4,6-7H2,1-2H3
InChIKeyCIDCCJOSEKVFEC-UHFFFAOYSA-N
MW277.30 g/mol
LogP-0.50
Rot. Bonds7

About methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate

methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate (PubChem CID 104600365) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate
PubChem CID104600365
Molecular FormulaC9H15N3O5S
Molecular Weight277.30 g/mol
Exact Mass277.07
IUPAC Namemethyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate
SMILESCOC(=O)CCN(C)S(=O)(=O)NCc1ccno1
InChIInChI=1S/C9H15N3O5S/c1-12(6-4-9(13)16-2)18(14,15)11-7-8-3-5-10-17-8/h3,5,11H,4,6-7H2,1-2H3
InChIKeyCIDCCJOSEKVFEC-UHFFFAOYSA-N
XLogP-0.50
TPSA101.74 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.30
LogP ≤ 5-0.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate?
The IUPAC name of methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate (CID 104600365) is methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate.
What is the SMILES notation for methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate?
The canonical SMILES for methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate is COC(=O)CCN(C)S(=O)(=O)NCc1ccno1.
What is the InChIKey of methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate?
The InChIKey is CIDCCJOSEKVFEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O5S/c1-12(6-4-9(13)16-2)18(14,15)11-7-8-3-5-10-17-8/h3,5,11H,4,6-7H2,1-2H3.
What are the key properties of methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate?
methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate has a molecular weight of 277.30 g/mol, XLogP of -0.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[methyl(1,2-oxazol-5-ylmethylsulfamoyl)amino]propanoate is sourced from PubChem (CID 104600365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).