C11H20N4O4S — CID 104693950
methyl 3-[methyl-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]amino]propanoate (PubChem CID 104693950) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 3-[methyl-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]amino]propanoate |
|---|---|
| PubChem CID | 104693950 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 3-[methyl-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NCCc1ccnn1C |
| InChI | InChI=1S/C11H20N4O4S/c1-14(9-6-11(16)19-3)20(17,18)13-8-5-10-4-7-12-15(10)2/h4,7,13H,5-6,8-9H2,1-3H3 |
| InChIKey | IHFQVXZGMFWSSB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |