C11H24N2O5S — CID 113351676
methyl 3-[6-hydroxyhexylsulfamoyl(methyl)amino]propanoate (PubChem CID 113351676) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 3-[6-hydroxyhexylsulfamoyl(methyl)amino]propanoate.
| Compound Name | methyl 3-[6-hydroxyhexylsulfamoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 113351676 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | methyl 3-[6-hydroxyhexylsulfamoyl(methyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NCCCCCCO |
| InChI | InChI=1S/C11H24N2O5S/c1-13(9-7-11(15)18-2)19(16,17)12-8-5-3-4-6-10-14/h12,14H,3-10H2,1-2H3 |
| InChIKey | BHVQWXGRMFPHNX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|