C8H18N4O5S — CID 83116212
methyl 3-[2-(carbamoylamino)ethylsulfamoyl-methylamino]propanoate (PubChem CID 83116212) has the molecular formula C8H18N4O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 3-[2-(carbamoylamino)ethylsulfamoyl-methylamino]propanoate.
| Compound Name | methyl 3-[2-(carbamoylamino)ethylsulfamoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 83116212 |
| Molecular Formula | C8H18N4O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 3-[2-(carbamoylamino)ethylsulfamoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NCCNC(N)=O |
| InChI | InChI=1S/C8H18N4O5S/c1-12(6-3-7(13)17-2)18(15,16)11-5-4-10-8(9)14/h11H,3-6H2,1-2H3,(H3,9,10,14) |
| InChIKey | WYGWYGINSFJODT-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|