methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate

C8H12N2O3 — CID 60670473

IUPACmethyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate
SMILESCOC(=O)CN(C)Cc1ccno1
InChIInChI=1S/C8H12N2O3/c1-10(6-8(11)12-2)5-7-3-4-9-13-7/h3-4H,5-6H2,1-2H3
InChIKeyYUGAPZHWYQTIBL-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.28
Rot. Bonds4

About methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate

methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate (PubChem CID 60670473) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate
PubChem CID60670473
Molecular FormulaC8H12N2O3
Molecular Weight184.19 g/mol
Exact Mass184.08
IUPAC Namemethyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate
SMILESCOC(=O)CN(C)Cc1ccno1
InChIInChI=1S/C8H12N2O3/c1-10(6-8(11)12-2)5-7-3-4-9-13-7/h3-4H,5-6H2,1-2H3
InChIKeyYUGAPZHWYQTIBL-UHFFFAOYSA-N
XLogP0.28
TPSA55.57 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate?
The IUPAC name of methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate (CID 60670473) is methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate.
What is the SMILES notation for methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate?
The canonical SMILES for methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate is COC(=O)CN(C)Cc1ccno1.
What is the InChIKey of methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate?
The InChIKey is YUGAPZHWYQTIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-10(6-8(11)12-2)5-7-3-4-9-13-7/h3-4H,5-6H2,1-2H3.
What are the key properties of methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate?
methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate has a molecular weight of 184.19 g/mol, XLogP of 0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(1,2-oxazol-5-ylmethyl)amino]acetate is sourced from PubChem (CID 60670473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).