C9H16N4O4S — CID 113433480
methyl 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoate (PubChem CID 113433480) has the molecular formula C9H16N4O4S and a molecular weight of 276.32 g/mol. Its IUPAC name is methyl 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoate |
|---|---|
| PubChem CID | 113433480 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)Nc1[nH]ncc1C |
| InChI | InChI=1S/C9H16N4O4S/c1-7-6-10-11-9(7)12-18(15,16)13(2)5-4-8(14)17-3/h6H,4-5H2,1-3H3,(H2,10,11,12) |
| InChIKey | LENBXOWNYDNWNC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |