C8H14N4O4S — CID 104617625
3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoic acid (PubChem CID 104617625) has the molecular formula C8H14N4O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 104617625 |
| Molecular Formula | C8H14N4O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-[methyl-[(4-methyl-1H-pyrazol-5-yl)sulfamoyl]amino]propanoic acid |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C8H14N4O4S/c1-6-5-9-10-8(6)11-17(15,16)12(2)4-3-7(13)14/h5H,3-4H2,1-2H3,(H,13,14)(H2,9,10,11) |
| InChIKey | XDIGLKRJFAZBOM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |