C10H18N4O4S — CID 107462282
3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl-methylamino]propanoic acid (PubChem CID 107462282) has the molecular formula C10H18N4O4S and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl-methylamino]propanoic acid.
| Compound Name | 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 107462282 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl-methylamino]propanoic acid |
| SMILES | CCc1nn(C)cc1NS(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C10H18N4O4S/c1-4-8-9(7-13(2)11-8)12-19(17,18)14(3)6-5-10(15)16/h7,12H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | XVCHQVNNENYJPN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |