C8H16N4OS — CID 164648393
3-ethyl-N-(ethylsulfonimidoyl)-1-methylpyrazol-4-amine (PubChem CID 164648393) has the molecular formula C8H16N4OS and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-ethyl-N-(ethylsulfonimidoyl)-1-methylpyrazol-4-amine.
| Compound Name | 3-ethyl-N-(ethylsulfonimidoyl)-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 164648393 |
| Molecular Formula | C8H16N4OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-ethyl-N-(ethylsulfonimidoyl)-1-methylpyrazol-4-amine |
| SMILES | [H]N=S(=O)(CC)Nc1cn(C)nc1CC |
| InChI | InChI=1S/C8H16N4OS/c1-4-7-8(6-12(3)10-7)11-14(9,13)5-2/h6H,4-5H2,1-3H3,(H2,9,11,13) |
| InChIKey | KKLOPVRWFFWOEG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |