C8H12N4O4S — CID 107587564
3-[methyl(pyrimidin-5-ylsulfamoyl)amino]propanoic acid (PubChem CID 107587564) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[methyl(pyrimidin-5-ylsulfamoyl)amino]propanoic acid.
| Compound Name | 3-[methyl(pyrimidin-5-ylsulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 107587564 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-[methyl(pyrimidin-5-ylsulfamoyl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)S(=O)(=O)Nc1cncnc1 |
| InChI | InChI=1S/C8H12N4O4S/c1-12(3-2-8(13)14)17(15,16)11-7-4-9-6-10-5-7/h4-6,11H,2-3H2,1H3,(H,13,14) |
| InChIKey | JIUMSHRDBKXGOI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |