C10H12BrClN2O4S — CID 103477657
3-[(2-bromo-3-chlorophenyl)sulfamoyl-methylamino]propanoic acid (PubChem CID 103477657) has the molecular formula C10H12BrClN2O4S and a molecular weight of 371.64 g/mol. Its IUPAC name is 3-[(2-bromo-3-chlorophenyl)sulfamoyl-methylamino]propanoic acid.
| Compound Name | 3-[(2-bromo-3-chlorophenyl)sulfamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 103477657 |
| Molecular Formula | C10H12BrClN2O4S |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 3-[(2-bromo-3-chlorophenyl)sulfamoyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)S(=O)(=O)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C10H12BrClN2O4S/c1-14(6-5-9(15)16)19(17,18)13-8-4-2-3-7(12)10(8)11/h2-4,13H,5-6H2,1H3,(H,15,16) |
| InChIKey | QOEJXWKHOIWWEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |