C11H14BrClN2O4S — CID 81264072
methyl 3-[(2-bromo-4-chlorophenyl)sulfamoyl-methylamino]propanoate (PubChem CID 81264072) has the molecular formula C11H14BrClN2O4S and a molecular weight of 385.67 g/mol. Its IUPAC name is methyl 3-[(2-bromo-4-chlorophenyl)sulfamoyl-methylamino]propanoate.
| Compound Name | methyl 3-[(2-bromo-4-chlorophenyl)sulfamoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 81264072 |
| Molecular Formula | C11H14BrClN2O4S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | methyl 3-[(2-bromo-4-chlorophenyl)sulfamoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H14BrClN2O4S/c1-15(6-5-11(16)19-2)20(17,18)14-10-4-3-8(13)7-9(10)12/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | XBUQDOCDOYALJE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |