C10H14BrClN2O3S — CID 114135273
2-bromo-4-chloro-1-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene (PubChem CID 114135273) has the molecular formula C10H14BrClN2O3S and a molecular weight of 357.66 g/mol. Its IUPAC name is 2-bromo-4-chloro-1-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene.
| Compound Name | 2-bromo-4-chloro-1-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 114135273 |
| Molecular Formula | C10H14BrClN2O3S |
| Molecular Weight | 357.66 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 2-bromo-4-chloro-1-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene |
| SMILES | CN(CCCO)S(=O)(=O)Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C10H14BrClN2O3S/c1-14(5-2-6-15)18(16,17)13-10-4-3-8(12)7-9(10)11/h3-4,7,13,15H,2,5-6H2,1H3 |
| InChIKey | ONZSYXZWMWRYDH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |