C10H14Cl2N2O3S — CID 114132444
1,3-dichloro-5-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene (PubChem CID 114132444) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 1,3-dichloro-5-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene.
| Compound Name | 1,3-dichloro-5-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 114132444 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1,3-dichloro-5-[[3-hydroxypropyl(methyl)sulfamoyl]amino]benzene |
| SMILES | CN(CCCO)S(=O)(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-14(3-2-4-15)18(16,17)13-10-6-8(11)5-9(12)7-10/h5-7,13,15H,2-4H2,1H3 |
| InChIKey | ZGLAANUMRNBGNS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |