C11H16Cl3N3O2S — CID 106057712
1,2,4-trichloro-5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene (PubChem CID 106057712) has the molecular formula C11H16Cl3N3O2S and a molecular weight of 360.69 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene.
| Compound Name | 1,2,4-trichloro-5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 106057712 |
| Molecular Formula | C11H16Cl3N3O2S |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 1,2,4-trichloro-5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl3N3O2S/c1-15-4-3-5-17(2)20(18,19)16-11-7-9(13)8(12)6-10(11)14/h6-7,15-16H,3-5H2,1-2H3 |
| InChIKey | LAXXOKWTNYBLHL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|