C12H21N3O3S — CID 106031237
1-methoxy-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene (PubChem CID 106031237) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-methoxy-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene.
| Compound Name | 1-methoxy-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 106031237 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-methoxy-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H21N3O3S/c1-13-9-4-10-15(2)19(16,17)14-11-5-7-12(18-3)8-6-11/h5-8,13-14H,4,9-10H2,1-3H3 |
| InChIKey | BVVHYMHMGWESEA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|