C13H23N3O3S — CID 106053283
1-methoxy-2-methyl-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene (PubChem CID 106053283) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-methoxy-2-methyl-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene.
| Compound Name | 1-methoxy-2-methyl-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 106053283 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-methoxy-2-methyl-4-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C13H23N3O3S/c1-11-10-12(6-7-13(11)19-4)15-20(17,18)16(3)9-5-8-14-2/h6-7,10,14-15H,5,8-9H2,1-4H3 |
| InChIKey | XFRGRKZLERTNNL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|