C14H25N3O3S — CID 106056051
1-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-4-methoxy-2-methylbenzene (PubChem CID 106056051) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-4-methoxy-2-methylbenzene.
| Compound Name | 1-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 106056051 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-4-methoxy-2-methylbenzene |
| SMILES | CCNCCCN(C)S(=O)(=O)Nc1ccc(OC)cc1C |
| InChI | InChI=1S/C14H25N3O3S/c1-5-15-9-6-10-17(3)21(18,19)16-14-8-7-13(20-4)11-12(14)2/h7-8,11,15-16H,5-6,9-10H2,1-4H3 |
| InChIKey | TWTPQANSJWLKDE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|