C12H19BrFN3O2S — CID 106067142
1-bromo-4-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-2-fluorobenzene (PubChem CID 106067142) has the molecular formula C12H19BrFN3O2S and a molecular weight of 368.27 g/mol. Its IUPAC name is 1-bromo-4-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-2-fluorobenzene.
| Compound Name | 1-bromo-4-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-2-fluorobenzene |
|---|---|
| PubChem CID | 106067142 |
| Molecular Formula | C12H19BrFN3O2S |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-bromo-4-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-2-fluorobenzene |
| SMILES | CCNCCCN(C)S(=O)(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H19BrFN3O2S/c1-3-15-7-4-8-17(2)20(18,19)16-10-5-6-11(13)12(14)9-10/h5-6,9,15-16H,3-4,7-8H2,1-2H3 |
| InChIKey | BJLAGYZCDGAJBG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|