C11H17BrN2O3S — CID 114134965
2-bromo-4-[[3-hydroxypropyl(methyl)sulfamoyl]amino]-1-methylbenzene (PubChem CID 114134965) has the molecular formula C11H17BrN2O3S and a molecular weight of 337.24 g/mol. Its IUPAC name is 2-bromo-4-[[3-hydroxypropyl(methyl)sulfamoyl]amino]-1-methylbenzene.
| Compound Name | 2-bromo-4-[[3-hydroxypropyl(methyl)sulfamoyl]amino]-1-methylbenzene |
|---|---|
| PubChem CID | 114134965 |
| Molecular Formula | C11H17BrN2O3S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-bromo-4-[[3-hydroxypropyl(methyl)sulfamoyl]amino]-1-methylbenzene |
| SMILES | Cc1ccc(NS(=O)(=O)N(C)CCCO)cc1Br |
| InChI | InChI=1S/C11H17BrN2O3S/c1-9-4-5-10(8-11(9)12)13-18(16,17)14(2)6-3-7-15/h4-5,8,13,15H,3,6-7H2,1-2H3 |
| InChIKey | MZDTUTCIULKYNJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |