C11H16BrF2N3O2S — CID 106066650
5-bromo-1,3-difluoro-2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene (PubChem CID 106066650) has the molecular formula C11H16BrF2N3O2S and a molecular weight of 372.24 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene.
| Compound Name | 5-bromo-1,3-difluoro-2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 106066650 |
| Molecular Formula | C11H16BrF2N3O2S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-bromo-1,3-difluoro-2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]benzene |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H16BrF2N3O2S/c1-15-4-3-5-17(2)20(18,19)16-11-9(13)6-8(12)7-10(11)14/h6-7,15-16H,3-5H2,1-2H3 |
| InChIKey | ISHZYJSJQMYWIU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|