C8H16N4O2S2 — CID 106031702
2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,3-thiazole (PubChem CID 106031702) has the molecular formula C8H16N4O2S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,3-thiazole.
| Compound Name | 2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,3-thiazole |
|---|---|
| PubChem CID | 106031702 |
| Molecular Formula | C8H16N4O2S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,3-thiazole |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H16N4O2S2/c1-9-4-3-6-12(2)16(13,14)11-8-10-5-7-15-8/h5,7,9H,3-4,6H2,1-2H3,(H,10,11) |
| InChIKey | GWFPBBJUESFMCV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|