C10H15N5O2S2 — CID 106031715
1-[3-(methylamino)propyl]-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide (PubChem CID 106031715) has the molecular formula C10H15N5O2S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 1-[3-(methylamino)propyl]-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[3-(methylamino)propyl]-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106031715 |
| Molecular Formula | C10H15N5O2S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[3-(methylamino)propyl]-N-(1,3-thiazol-2-yl)pyrazole-4-sulfonamide |
| SMILES | CNCCCn1cc(S(=O)(=O)Nc2nccs2)cn1 |
| InChI | InChI=1S/C10H15N5O2S2/c1-11-3-2-5-15-8-9(7-13-15)19(16,17)14-10-12-4-6-18-10/h4,6-8,11H,2-3,5H2,1H3,(H,12,14) |
| InChIKey | KJULJXUYNAZZMW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|