C11H16N6O3S — CID 106081763
1-[3-(methylamino)propyl]-N-(6-oxo-1H-pyridazin-3-yl)pyrazole-4-sulfonamide (PubChem CID 106081763) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[3-(methylamino)propyl]-N-(6-oxo-1H-pyridazin-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[3-(methylamino)propyl]-N-(6-oxo-1H-pyridazin-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106081763 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[3-(methylamino)propyl]-N-(6-oxo-1H-pyridazin-3-yl)pyrazole-4-sulfonamide |
| SMILES | CNCCCn1cc(S(=O)(=O)Nc2ccc(=O)[nH]n2)cn1 |
| InChI | InChI=1S/C11H16N6O3S/c1-12-5-2-6-17-8-9(7-13-17)21(19,20)16-10-3-4-11(18)15-14-10/h3-4,7-8,12H,2,5-6H2,1H3,(H,14,16)(H,15,18) |
| InChIKey | PQEGGVSBFSERCC-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|