C10H19N3O2S2 — CID 106031673
4-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)butane-1-sulfonamide (PubChem CID 106031673) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)butane-1-sulfonamide.
| Compound Name | 4-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106031673 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H19N3O2S2/c1-9(2)11-5-3-4-8-17(14,15)13-10-12-6-7-16-10/h6-7,9,11H,3-5,8H2,1-2H3,(H,12,13) |
| InChIKey | XMLZQZKFNCONKG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|