C10H20N4O2S2 — CID 106082732
N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106082732) has the molecular formula C10H20N4O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106082732 |
| Molecular Formula | C10H20N4O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)CCCCNC(C)C)s1 |
| InChI | InChI=1S/C10H20N4O2S2/c1-8(2)11-6-4-5-7-18(15,16)14-10-13-12-9(3)17-10/h8,11H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | YBVYLLDDFFNMJW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|